About 2-N,3-N-bis(methylsulfanyl)heptane-2,3-diamine
2-N,3-N-bis(methylsulfanyl)heptane-2,3-diamine (PubChem CID 146886349) has the molecular formula C9H22N2S2
and a molecular weight of 222.42 g/mol. Its IUPAC name is 2-N,3-N-bis(methylsulfanyl)heptane-2,3-diamine.
Molecular Properties
| Compound Name | 2-N,3-N-bis(methylsulfanyl)heptane-2,3-diamine |
| PubChem CID | 146886349 |
| Molecular Formula | C9H22N2S2 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 2-N,3-N-bis(methylsulfanyl)heptane-2,3-diamine |
| SMILES | CCCCC(NSC)C(C)NSC |
| InChI | InChI=1S/C9H22N2S2/c1-5-6-7-9(11-13-4)8(2)10-12-3/h8-11H,5-7H2,1-4H3 |
| InChIKey | SWWJOBXWNNBRML-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-N,3-N-bis(methylsulfanyl)heptane-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,3-N-bis(methylsulfanyl)heptane-2,3-diamine?
The IUPAC name of 2-N,3-N-bis(methylsulfanyl)heptane-2,3-diamine (CID 146886349) is 2-N,3-N-bis(methylsulfanyl)heptane-2,3-diamine.
What is the SMILES notation for 2-N,3-N-bis(methylsulfanyl)heptane-2,3-diamine?
The canonical SMILES for 2-N,3-N-bis(methylsulfanyl)heptane-2,3-diamine is CCCCC(NSC)C(C)NSC.
What is the InChIKey of 2-N,3-N-bis(methylsulfanyl)heptane-2,3-diamine?
The InChIKey is SWWJOBXWNNBRML-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2S2/c1-5-6-7-9(11-13-4)8(2)10-12-3/h8-11H,5-7H2,1-4H3.
What are the key properties of 2-N,3-N-bis(methylsulfanyl)heptane-2,3-diamine?
2-N,3-N-bis(methylsulfanyl)heptane-2,3-diamine has a molecular weight of 222.42 g/mol, XLogP of 2.67, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,3-N-bis(methylsulfanyl)heptane-2,3-diamine is sourced from PubChem (CID 146886349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).