About 1-N,4-N-bis(1H-benzimidazol-2-yl)benzene-1,4-diamine
1-N,4-N-bis(1H-benzimidazol-2-yl)benzene-1,4-diamine (PubChem CID 14688882) has the molecular formula C20H16N6
and a molecular weight of 340.39 g/mol. Its IUPAC name is 1-N,4-N-bis(1H-benzimidazol-2-yl)benzene-1,4-diamine.
Molecular Properties
| Compound Name | 1-N,4-N-bis(1H-benzimidazol-2-yl)benzene-1,4-diamine |
| PubChem CID | 14688882 |
| Molecular Formula | C20H16N6 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-N,4-N-bis(1H-benzimidazol-2-yl)benzene-1,4-diamine |
| SMILES | c1ccc2[nH]c(Nc3ccc(Nc4nc5ccccc5[nH]4)cc3)nc2c1 |
| InChI | InChI=1S/C20H16N6/c1-2-6-16-15(5-1)23-19(24-16)21-13-9-11-14(12-10-13)22-20-25-17-7-3-4-8-18(17)26-20/h1-12H,(H2,21,23,24)(H2,22,25,26) |
| InChIKey | MOWJLIRPLBUMJZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N,4-N-bis(1H-benzimidazol-2-yl)benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,4-N-bis(1H-benzimidazol-2-yl)benzene-1,4-diamine?
The IUPAC name of 1-N,4-N-bis(1H-benzimidazol-2-yl)benzene-1,4-diamine (CID 14688882) is 1-N,4-N-bis(1H-benzimidazol-2-yl)benzene-1,4-diamine.
What is the SMILES notation for 1-N,4-N-bis(1H-benzimidazol-2-yl)benzene-1,4-diamine?
The canonical SMILES for 1-N,4-N-bis(1H-benzimidazol-2-yl)benzene-1,4-diamine is c1ccc2[nH]c(Nc3ccc(Nc4nc5ccccc5[nH]4)cc3)nc2c1.
What is the InChIKey of 1-N,4-N-bis(1H-benzimidazol-2-yl)benzene-1,4-diamine?
The InChIKey is MOWJLIRPLBUMJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N6/c1-2-6-16-15(5-1)23-19(24-16)21-13-9-11-14(12-10-13)22-20-25-17-7-3-4-8-18(17)26-20/h1-12H,(H2,21,23,24)(H2,22,25,26).
What are the key properties of 1-N,4-N-bis(1H-benzimidazol-2-yl)benzene-1,4-diamine?
1-N,4-N-bis(1H-benzimidazol-2-yl)benzene-1,4-diamine has a molecular weight of 340.39 g/mol, XLogP of 4.93, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,4-N-bis(1H-benzimidazol-2-yl)benzene-1,4-diamine is sourced from PubChem (CID 14688882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).