C21H18N4O3 — CID 146889192
2-[1-(3,5-dimethoxyphenyl)-2-imino-4-oxopyrrolidin-3-ylidene]-1,3-dihydroindole-7-carbonitrile (PubChem CID 146889192) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-[1-(3,5-dimethoxyphenyl)-2-imino-4-oxopyrrolidin-3-ylidene]-1,3-dihydroindole-7-carbonitrile.
| Compound Name | 2-[1-(3,5-dimethoxyphenyl)-2-imino-4-oxopyrrolidin-3-ylidene]-1,3-dihydroindole-7-carbonitrile |
|---|---|
| PubChem CID | 146889192 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-[1-(3,5-dimethoxyphenyl)-2-imino-4-oxopyrrolidin-3-ylidene]-1,3-dihydroindole-7-carbonitrile |
| SMILES | [H]/N=C1/C(=C2Cc3cccc(C#N)c3N2)C(=O)CN1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C21H18N4O3/c1-27-15-7-14(8-16(9-15)28-2)25-11-18(26)19(21(25)23)17-6-12-4-3-5-13(10-22)20(12)24-17/h3-5,7-9,23-24H,6,11H2,1-2H3/b19-17?,23-21- |
| InChIKey | CSYAHAKMUFNWPX-LJAWIZQSSA-N |
| XLogP | 2.86 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|