C19H17N3O3S2 — CID 146890755
4-[3-[5-cyclopropyl-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-3-oxopropyl]-N-hydroxybenzamide (PubChem CID 146890755) has the molecular formula C19H17N3O3S2 and a molecular weight of 399.50 g/mol. Its IUPAC name is 4-[3-[5-cyclopropyl-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-3-oxopropyl]-N-hydroxybenzamide.
| Compound Name | 4-[3-[5-cyclopropyl-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-3-oxopropyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 146890755 |
| Molecular Formula | C19H17N3O3S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 4-[3-[5-cyclopropyl-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-3-oxopropyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(CCC(=O)c2nc(-c3nccs3)sc2C2CC2)cc1 |
| InChI | InChI=1S/C19H17N3O3S2/c23-14(8-3-11-1-4-13(5-2-11)17(24)22-25)15-16(12-6-7-12)27-19(21-15)18-20-9-10-26-18/h1-2,4-5,9-10,12,25H,3,6-8H2,(H,22,24) |
| InChIKey | SZNOGRBLVPIKNY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|