C20H30O2 — CID 14689112
4-(2,6-dimethylhept-5-enyl)-2-ethoxy-3,4-dihydro-2H-chromene (PubChem CID 14689112) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 4-(2,6-dimethylhept-5-enyl)-2-ethoxy-3,4-dihydro-2H-chromene.
| Compound Name | 4-(2,6-dimethylhept-5-enyl)-2-ethoxy-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 14689112 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 4-(2,6-dimethylhept-5-enyl)-2-ethoxy-3,4-dihydro-2H-chromene |
| SMILES | CCOC1CC(CC(C)CCC=C(C)C)c2ccccc2O1 |
| InChI | InChI=1S/C20H30O2/c1-5-21-20-14-17(13-16(4)10-8-9-15(2)3)18-11-6-7-12-19(18)22-20/h6-7,9,11-12,16-17,20H,5,8,10,13-14H2,1-4H3 |
| InChIKey | NLTVNKRTAVEDSO-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|