C16H8Cl2F2N6O4 — CID 146894935
2-[3,5-dichloro-4-[[5-(2,2-difluoroethyl)-6-oxo-1H-pyridazin-3-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (PubChem CID 146894935) has the molecular formula C16H8Cl2F2N6O4 and a molecular weight of 457.18 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[[5-(2,2-difluoroethyl)-6-oxo-1H-pyridazin-3-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile.
| Compound Name | 2-[3,5-dichloro-4-[[5-(2,2-difluoroethyl)-6-oxo-1H-pyridazin-3-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
|---|---|
| PubChem CID | 146894935 |
| Molecular Formula | C16H8Cl2F2N6O4 |
| Molecular Weight | 457.18 g/mol |
| Exact Mass | 456.00 |
| IUPAC Name | 2-[3,5-dichloro-4-[[5-(2,2-difluoroethyl)-6-oxo-1H-pyridazin-3-yl]oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| SMILES | N#Cc1nn(-c2cc(Cl)c(Oc3cc(CC(F)F)c(=O)[nH]n3)c(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H8Cl2F2N6O4/c17-8-3-7(26-16(29)22-15(28)10(5-21)25-26)4-9(18)13(8)30-12-2-6(1-11(19)20)14(27)24-23-12/h2-4,11H,1H2,(H,24,27)(H,22,28,29) |
| InChIKey | TWLLTZLBBSTCGW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 146.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.18 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |