C20H22N4O2 — CID 146896036
4-[(3S)-3-methyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]-1-(oxan-4-yl)pyridin-2-one (PubChem CID 146896036) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-[(3S)-3-methyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]-1-(oxan-4-yl)pyridin-2-one.
| Compound Name | 4-[(3S)-3-methyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]-1-(oxan-4-yl)pyridin-2-one |
|---|---|
| PubChem CID | 146896036 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 4-[(3S)-3-methyl-2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl]-1-(oxan-4-yl)pyridin-2-one |
| SMILES | C[C@H]1CCc2nc3ccc(-c4ccn(C5CCOCC5)c(=O)c4)nc3n21 |
| InChI | InChI=1S/C20H22N4O2/c1-13-2-5-18-21-17-4-3-16(22-20(17)24(13)18)14-6-9-23(19(25)12-14)15-7-10-26-11-8-15/h3-4,6,9,12-13,15H,2,5,7-8,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | UBMXFQWYYQHCFE-ZDUSSCGKSA-N |
| XLogP | 3.12 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |