C27H23FN2O2 — CID 146896813
(3S)-4-(5-fluoro-6-phenylindol-1-yl)-3-hydroxy-1-(4-isocyano-3-methylphenyl)-3-methylbutan-2-one (PubChem CID 146896813) has the molecular formula C27H23FN2O2 and a molecular weight of 426.49 g/mol. Its IUPAC name is (3S)-4-(5-fluoro-6-phenylindol-1-yl)-3-hydroxy-1-(4-isocyano-3-methylphenyl)-3-methylbutan-2-one.
| Compound Name | (3S)-4-(5-fluoro-6-phenylindol-1-yl)-3-hydroxy-1-(4-isocyano-3-methylphenyl)-3-methylbutan-2-one |
|---|---|
| PubChem CID | 146896813 |
| Molecular Formula | C27H23FN2O2 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | (3S)-4-(5-fluoro-6-phenylindol-1-yl)-3-hydroxy-1-(4-isocyano-3-methylphenyl)-3-methylbutan-2-one |
| SMILES | [C-]#[N+]c1ccc(CC(=O)[C@@](C)(O)Cn2ccc3cc(F)c(-c4ccccc4)cc32)cc1C |
| InChI | InChI=1S/C27H23FN2O2/c1-18-13-19(9-10-24(18)29-3)14-26(31)27(2,32)17-30-12-11-21-15-23(28)22(16-25(21)30)20-7-5-4-6-8-20/h4-13,15-16,32H,14,17H2,1-2H3/t27-/m0/s1 |
| InChIKey | UCMFGPWTZYKJNP-MHZLTWQESA-N |
| XLogP | 5.87 |
| TPSA | 46.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|