C11H14O5 — CID 14689919
5-(ethoxymethyl)-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione (PubChem CID 14689919) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is 5-(ethoxymethyl)-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 5-(ethoxymethyl)-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 14689919 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 5-(ethoxymethyl)-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione |
| SMILES | CCOCC1=CC(=O)C(OC)=C(OC)C1=O |
| InChI | InChI=1S/C11H14O5/c1-4-16-6-7-5-8(12)10(14-2)11(15-3)9(7)13/h5H,4,6H2,1-3H3 |
| InChIKey | ZHTRLFJHCFWMPR-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|