About iridium;4-(2H-naphthalen-2-id-1-yl)thieno[3,2-c]pyridine;pent-2-ene-2,4-diol
iridium;4-(2H-naphthalen-2-id-1-yl)thieno[3,2-c]pyridine;pent-2-ene-2,4-diol (PubChem CID 146899299) has the molecular formula C22H20IrNO2S-
and a molecular weight of 554.69 g/mol. Its IUPAC name is iridium;4-(2H-naphthalen-2-id-1-yl)thieno[3,2-c]pyridine;pent-2-ene-2,4-diol.
Molecular Properties
| Compound Name | iridium;4-(2H-naphthalen-2-id-1-yl)thieno[3,2-c]pyridine;pent-2-ene-2,4-diol |
| PubChem CID | 146899299 |
| Molecular Formula | C22H20IrNO2S- |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 555.08 |
| IUPAC Name | iridium;4-(2H-naphthalen-2-id-1-yl)thieno[3,2-c]pyridine;pent-2-ene-2,4-diol |
| SMILES | CC(O)=CC(C)O.[Ir].[c-]1ccc2ccccc2c1-c1nccc2sccc12 |
| InChI | InChI=1S/C17H10NS.C5H10O2.Ir/c1-2-6-13-12(4-1)5-3-7-14(13)17-15-9-11-19-16(15)8-10-18-17;1-4(6)3-5(2)7;/h1-6,8-11H;3-4,6-7H,1-2H3;/q-1;; |
| InChIKey | DUSHASSBUPCXAH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;4-(2H-naphthalen-2-id-1-yl)thieno[3,2-c]pyridine;pent-2-ene-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;4-(2H-naphthalen-2-id-1-yl)thieno[3,2-c]pyridine;pent-2-ene-2,4-diol?
The IUPAC name of iridium;4-(2H-naphthalen-2-id-1-yl)thieno[3,2-c]pyridine;pent-2-ene-2,4-diol (CID 146899299) is iridium;4-(2H-naphthalen-2-id-1-yl)thieno[3,2-c]pyridine;pent-2-ene-2,4-diol.
What is the SMILES notation for iridium;4-(2H-naphthalen-2-id-1-yl)thieno[3,2-c]pyridine;pent-2-ene-2,4-diol?
The canonical SMILES for iridium;4-(2H-naphthalen-2-id-1-yl)thieno[3,2-c]pyridine;pent-2-ene-2,4-diol is CC(O)=CC(C)O.[Ir].[c-]1ccc2ccccc2c1-c1nccc2sccc12.
What is the InChIKey of iridium;4-(2H-naphthalen-2-id-1-yl)thieno[3,2-c]pyridine;pent-2-ene-2,4-diol?
The InChIKey is DUSHASSBUPCXAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10NS.C5H10O2.Ir/c1-2-6-13-12(4-1)5-3-7-14(13)17-15-9-11-19-16(15)8-10-18-17;1-4(6)3-5(2)7;/h1-6,8-11H;3-4,6-7H,1-2H3;/q-1;;.
What are the key properties of iridium;4-(2H-naphthalen-2-id-1-yl)thieno[3,2-c]pyridine;pent-2-ene-2,4-diol?
iridium;4-(2H-naphthalen-2-id-1-yl)thieno[3,2-c]pyridine;pent-2-ene-2,4-diol has a molecular weight of 554.69 g/mol, XLogP of 5.74, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;4-(2H-naphthalen-2-id-1-yl)thieno[3,2-c]pyridine;pent-2-ene-2,4-diol is sourced from PubChem (CID 146899299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).