C48H38F6MnN8+5 — CID 146899554
5,10-bis(1-ethylpyridin-1-ium-3-yl)-15,20-bis[1-(2,2,2-trifluoroethyl)pyridin-1-ium-3-yl]porphyrin-21,23-diide;manganese(3+) (PubChem CID 146899554) has the molecular formula C48H38F6MnN8+5 and a molecular weight of 895.81 g/mol. Its IUPAC name is 5,10-bis(1-ethylpyridin-1-ium-3-yl)-15,20-bis[1-(2,2,2-trifluoroethyl)pyridin-1-ium-3-yl]porphyrin-21,23-diide;manganese(3+).
| Compound Name | 5,10-bis(1-ethylpyridin-1-ium-3-yl)-15,20-bis[1-(2,2,2-trifluoroethyl)pyridin-1-ium-3-yl]porphyrin-21,23-diide;manganese(3+) |
|---|---|
| PubChem CID | 146899554 |
| Molecular Formula | C48H38F6MnN8+5 |
| Molecular Weight | 895.81 g/mol |
| Exact Mass | 895.25 |
| IUPAC Name | 5,10-bis(1-ethylpyridin-1-ium-3-yl)-15,20-bis[1-(2,2,2-trifluoroethyl)pyridin-1-ium-3-yl]porphyrin-21,23-diide;manganese(3+) |
| SMILES | CC[n+]1cccc(-c2c3nc(c(-c4ccc[n+](CC)c4)c4ccc([n-]4)c(-c4ccc[n+](CC(F)(F)F)c4)c4nc(c(-c5ccc[n+](CC(F)(F)F)c5)c5ccc2[n-]5)C=C4)C=C3)c1.[Mn+3] |
| InChI | InChI=1S/C48H38F6N8.Mn/c1-3-59-21-5-9-31(25-59)43-35-13-14-36(55-35)44(32-10-6-22-60(4-2)26-32)38-16-18-40(57-38)46(34-12-8-24-62(28-34)30-48(52,53)54)42-20-19-41(58-42)45(39-17-15-37(43)56-39)33-11-7-23-61(27-33)29-47(49,50)51;/h5-28H,3-4,29-30H2,1-2H3;/q+2;+3/b43-35-,43-37-,44-36-,44-38-,45-39-,45-41-,46-40-,46-42-; |
| InChIKey | ZJFVCOXLQLUPOJ-ZNCOPPMJSA-N |
| XLogP | 8.89 |
| TPSA | 69.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.81 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|