C48H35F9MnN8+5 — CID 146899556
5-(1-ethylpyridin-1-ium-2-yl)-10,15,20-tris[1-(2,2,2-trifluoroethyl)pyridin-1-ium-2-yl]porphyrin-22,24-diide;manganese(3+) (PubChem CID 146899556) has the molecular formula C48H35F9MnN8+5 and a molecular weight of 949.78 g/mol. Its IUPAC name is 5-(1-ethylpyridin-1-ium-2-yl)-10,15,20-tris[1-(2,2,2-trifluoroethyl)pyridin-1-ium-2-yl]porphyrin-22,24-diide;manganese(3+).
| Compound Name | 5-(1-ethylpyridin-1-ium-2-yl)-10,15,20-tris[1-(2,2,2-trifluoroethyl)pyridin-1-ium-2-yl]porphyrin-22,24-diide;manganese(3+) |
|---|---|
| PubChem CID | 146899556 |
| Molecular Formula | C48H35F9MnN8+5 |
| Molecular Weight | 949.78 g/mol |
| Exact Mass | 949.22 |
| IUPAC Name | 5-(1-ethylpyridin-1-ium-2-yl)-10,15,20-tris[1-(2,2,2-trifluoroethyl)pyridin-1-ium-2-yl]porphyrin-22,24-diide;manganese(3+) |
| SMILES | CC[n+]1ccccc1-c1c2nc(c(-c3cccc[n+]3CC(F)(F)F)c3ccc([n-]3)c(-c3cccc[n+]3CC(F)(F)F)c3nc(c(-c4cccc[n+]4CC(F)(F)F)c4ccc1[n-]4)C=C3)C=C2.[Mn+3] |
| InChI | InChI=1S/C48H35F9N8.Mn/c1-2-62-23-7-3-11-38(62)42-30-15-17-32(58-30)43(39-12-4-8-24-63(39)27-46(49,50)51)34-19-21-36(60-34)45(41-14-6-10-26-65(41)29-48(55,56)57)37-22-20-35(61-37)44(33-18-16-31(42)59-33)40-13-5-9-25-64(40)28-47(52,53)54;/h3-26H,2,27-29H2,1H3;/q+2;+3 |
| InChIKey | AKNMSMTYMDWWMN-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 69.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.78 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|