C29H42FN3O5 — CID 146899637
(1R)-2-acetyl-N-(2-fluorophenyl)-7-methoxy-1-(methoxymethoxymethyl)spiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide (PubChem CID 146899637) has the molecular formula C29H42FN3O5 and a molecular weight of 531.67 g/mol. Its IUPAC name is (1R)-2-acetyl-N-(2-fluorophenyl)-7-methoxy-1-(methoxymethoxymethyl)spiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide.
| Compound Name | (1R)-2-acetyl-N-(2-fluorophenyl)-7-methoxy-1-(methoxymethoxymethyl)spiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 146899637 |
| Molecular Formula | C29H42FN3O5 |
| Molecular Weight | 531.67 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | (1R)-2-acetyl-N-(2-fluorophenyl)-7-methoxy-1-(methoxymethoxymethyl)spiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide |
| SMILES | COCOC[C@H]1C2CC3CC(OC)CCC3C2C2(CCN(C(=O)Nc3ccccc3F)CC2)CN1C(C)=O |
| InChI | InChI=1S/C29H42FN3O5/c1-19(34)33-17-29(10-12-32(13-11-29)28(35)31-25-7-5-4-6-24(25)30)27-22-9-8-21(37-3)14-20(22)15-23(27)26(33)16-38-18-36-2/h4-7,20-23,26-27H,8-18H2,1-3H3,(H,31,35)/t20?,21?,22?,23?,26-,27?/m0/s1 |
| InChIKey | MEPWWKABJYGGMS-OVKJAJFBSA-N |
| XLogP | 4.36 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.67 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|