C27H37F2N3O4 — CID 146899683
(1R)-2-acetyl-N-(2,4-difluorophenyl)-1-(hydroxymethyl)-7-methoxyspiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide (PubChem CID 146899683) has the molecular formula C27H37F2N3O4 and a molecular weight of 505.61 g/mol. Its IUPAC name is (1R)-2-acetyl-N-(2,4-difluorophenyl)-1-(hydroxymethyl)-7-methoxyspiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide.
| Compound Name | (1R)-2-acetyl-N-(2,4-difluorophenyl)-1-(hydroxymethyl)-7-methoxyspiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 146899683 |
| Molecular Formula | C27H37F2N3O4 |
| Molecular Weight | 505.61 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | (1R)-2-acetyl-N-(2,4-difluorophenyl)-1-(hydroxymethyl)-7-methoxyspiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide |
| SMILES | COC1CCC2C(C1)CC1C2C2(CCN(C(=O)Nc3ccc(F)cc3F)CC2)CN(C(C)=O)[C@H]1CO |
| InChI | InChI=1S/C27H37F2N3O4/c1-16(34)32-15-27(25-20-5-4-19(36-2)11-17(20)12-21(25)24(32)14-33)7-9-31(10-8-27)26(35)30-23-6-3-18(28)13-22(23)29/h3,6,13,17,19-21,24-25,33H,4-5,7-12,14-15H2,1-2H3,(H,30,35)/t17?,19?,20?,21?,24-,25?/m0/s1 |
| InChIKey | GGUAKNFLXXSUEQ-HEVVDVNVSA-N |
| XLogP | 3.87 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.61 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |