C27H38FN3O4 — CID 146899686
(1R)-2-acetyl-N-(2-fluorophenyl)-1-(hydroxymethyl)-7-methoxyspiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide (PubChem CID 146899686) has the molecular formula C27H38FN3O4 and a molecular weight of 487.62 g/mol. Its IUPAC name is (1R)-2-acetyl-N-(2-fluorophenyl)-1-(hydroxymethyl)-7-methoxyspiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide.
| Compound Name | (1R)-2-acetyl-N-(2-fluorophenyl)-1-(hydroxymethyl)-7-methoxyspiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 146899686 |
| Molecular Formula | C27H38FN3O4 |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | (1R)-2-acetyl-N-(2-fluorophenyl)-1-(hydroxymethyl)-7-methoxyspiro[3,4a,4b,5,6,7,8,8a,9,9a-decahydro-1H-indeno[2,1-c]pyridine-4,4'-piperidine]-1'-carboxamide |
| SMILES | COC1CCC2C(C1)CC1C2C2(CCN(C(=O)Nc3ccccc3F)CC2)CN(C(C)=O)[C@H]1CO |
| InChI | InChI=1S/C27H38FN3O4/c1-17(33)31-16-27(9-11-30(12-10-27)26(34)29-23-6-4-3-5-22(23)28)25-20-8-7-19(35-2)13-18(20)14-21(25)24(31)15-32/h3-6,18-21,24-25,32H,7-16H2,1-2H3,(H,29,34)/t18?,19?,20?,21?,24-,25?/m0/s1 |
| InChIKey | SSBRFPGTBBPTBD-ONYQPHQESA-N |
| XLogP | 3.73 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |