About 2-aminobut-1-ene-1-thiol
2-aminobut-1-ene-1-thiol (PubChem CID 146899775) has the molecular formula C4H8NS-
and a molecular weight of 102.18 g/mol. Its IUPAC name is 2-aminobut-1-ene-1-thiol.
Molecular Properties
| Compound Name | 2-aminobut-1-ene-1-thiol |
| PubChem CID | 146899775 |
| Molecular Formula | C4H8NS- |
| Molecular Weight | 102.18 g/mol |
| Exact Mass | 102.04 |
| IUPAC Name | 2-aminobut-1-ene-1-thiol |
| SMILES | CC/C(N)=[C-]\S |
| InChI | InChI=1S/C4H8NS/c1-2-4(5)3-6/h6H,2,5H2,1H3/q-1 |
| InChIKey | NAYMVPDYWGNQDT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.18 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobut-1-ene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobut-1-ene-1-thiol?
The IUPAC name of 2-aminobut-1-ene-1-thiol (CID 146899775) is 2-aminobut-1-ene-1-thiol.
What is the SMILES notation for 2-aminobut-1-ene-1-thiol?
The canonical SMILES for 2-aminobut-1-ene-1-thiol is CC/C(N)=[C-]\S.
What is the InChIKey of 2-aminobut-1-ene-1-thiol?
The InChIKey is NAYMVPDYWGNQDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8NS/c1-2-4(5)3-6/h6H,2,5H2,1H3/q-1.
What are the key properties of 2-aminobut-1-ene-1-thiol?
2-aminobut-1-ene-1-thiol has a molecular weight of 102.18 g/mol, XLogP of 0.93, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobut-1-ene-1-thiol is sourced from PubChem (CID 146899775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).