C32H37N5O2 — CID 146899896
3-(4-amino-N-methylanilino)-5-[4-[(dimethylamino)methyl]phenyl]-N-[(4,6-dimethyl-2-oxo-3H-pyridin-3-yl)methyl]-2-methylbenzamide (PubChem CID 146899896) has the molecular formula C32H37N5O2 and a molecular weight of 523.68 g/mol. Its IUPAC name is 3-(4-amino-N-methylanilino)-5-[4-[(dimethylamino)methyl]phenyl]-N-[(4,6-dimethyl-2-oxo-3H-pyridin-3-yl)methyl]-2-methylbenzamide.
| Compound Name | 3-(4-amino-N-methylanilino)-5-[4-[(dimethylamino)methyl]phenyl]-N-[(4,6-dimethyl-2-oxo-3H-pyridin-3-yl)methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 146899896 |
| Molecular Formula | C32H37N5O2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | 3-(4-amino-N-methylanilino)-5-[4-[(dimethylamino)methyl]phenyl]-N-[(4,6-dimethyl-2-oxo-3H-pyridin-3-yl)methyl]-2-methylbenzamide |
| SMILES | CC1=CC(C)=NC(=O)C1CNC(=O)c1cc(-c2ccc(CN(C)C)cc2)cc(N(C)c2ccc(N)cc2)c1C |
| InChI | InChI=1S/C32H37N5O2/c1-20-15-21(2)35-32(39)29(20)18-34-31(38)28-16-25(24-9-7-23(8-10-24)19-36(4)5)17-30(22(28)3)37(6)27-13-11-26(33)12-14-27/h7-17,29H,18-19,33H2,1-6H3,(H,34,38) |
| InChIKey | OVROARWNWVMOMX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|