C16H35N — CID 146900012
(5S)-N,2,3,3,4,5,6,6-octamethyloctan-2-amine (PubChem CID 146900012) has the molecular formula C16H35N and a molecular weight of 241.46 g/mol. Its IUPAC name is (5S)-N,2,3,3,4,5,6,6-octamethyloctan-2-amine.
| Compound Name | (5S)-N,2,3,3,4,5,6,6-octamethyloctan-2-amine |
|---|---|
| PubChem CID | 146900012 |
| Molecular Formula | C16H35N |
| Molecular Weight | 241.46 g/mol |
| Exact Mass | 241.28 |
| IUPAC Name | (5S)-N,2,3,3,4,5,6,6-octamethyloctan-2-amine |
| SMILES | CCC(C)(C)[C@@H](C)C(C)C(C)(C)C(C)(C)NC |
| InChI | InChI=1S/C16H35N/c1-11-14(4,5)12(2)13(3)15(6,7)16(8,9)17-10/h12-13,17H,11H2,1-10H3/t12-,13?/m0/s1 |
| InChIKey | PRIWAONXVPYOKY-UEWDXFNNSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |