About 9-bicyclo[6.1.0]non-4-ynyl 4-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]butanoate
9-bicyclo[6.1.0]non-4-ynyl 4-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]butanoate (PubChem CID 146906449) has the molecular formula C21H25Br2NO6
and a molecular weight of 547.24 g/mol. Its IUPAC name is 9-bicyclo[6.1.0]non-4-ynyl 4-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]butanoate.
Molecular Properties
| Compound Name | 9-bicyclo[6.1.0]non-4-ynyl 4-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]butanoate |
| PubChem CID | 146906449 |
| Molecular Formula | C21H25Br2NO6 |
| Molecular Weight | 547.24 g/mol |
| Exact Mass | 545.00 |
| IUPAC Name | 9-bicyclo[6.1.0]non-4-ynyl 4-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]butanoate |
| SMILES | O=C(CCCOCCOCCN1C(=O)C(Br)=C(Br)C1=O)OC1C2CCC#CCCC21 |
| InChI | InChI=1S/C21H25Br2NO6/c22-17-18(23)21(27)24(20(17)26)9-11-29-13-12-28-10-5-8-16(25)30-19-14-6-3-1-2-4-7-15(14)19/h14-15,19H,3-13H2 |
| InChIKey | AALSIMZSUDFUCL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 547.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-bicyclo[6.1.0]non-4-ynyl 4-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bicyclo[6.1.0]non-4-ynyl 4-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]butanoate?
The IUPAC name of 9-bicyclo[6.1.0]non-4-ynyl 4-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]butanoate (CID 146906449) is 9-bicyclo[6.1.0]non-4-ynyl 4-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]butanoate.
What is the SMILES notation for 9-bicyclo[6.1.0]non-4-ynyl 4-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]butanoate?
The canonical SMILES for 9-bicyclo[6.1.0]non-4-ynyl 4-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]butanoate is O=C(CCCOCCOCCN1C(=O)C(Br)=C(Br)C1=O)OC1C2CCC#CCCC21.
What is the InChIKey of 9-bicyclo[6.1.0]non-4-ynyl 4-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]butanoate?
The InChIKey is AALSIMZSUDFUCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25Br2NO6/c22-17-18(23)21(27)24(20(17)26)9-11-29-13-12-28-10-5-8-16(25)30-19-14-6-3-1-2-4-7-15(14)19/h14-15,19H,3-13H2.
What are the key properties of 9-bicyclo[6.1.0]non-4-ynyl 4-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]butanoate?
9-bicyclo[6.1.0]non-4-ynyl 4-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]butanoate has a molecular weight of 547.24 g/mol, XLogP of 2.91, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bicyclo[6.1.0]non-4-ynyl 4-[2-[2-(3,4-dibromo-2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]butanoate is sourced from PubChem (CID 146906449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).