About 3-[2-[3-[2-(3,5-difluorophenyl)sulfonylethyl]phenyl]ethynyl]-2-pyrrol-1-ylbenzoic acid
3-[2-[3-[2-(3,5-difluorophenyl)sulfonylethyl]phenyl]ethynyl]-2-pyrrol-1-ylbenzoic acid (PubChem CID 146907504) has the molecular formula C27H19F2NO4S
and a molecular weight of 491.52 g/mol. Its IUPAC name is 3-[2-[3-[2-(3,5-difluorophenyl)sulfonylethyl]phenyl]ethynyl]-2-pyrrol-1-ylbenzoic acid.
Molecular Properties
| Compound Name | 3-[2-[3-[2-(3,5-difluorophenyl)sulfonylethyl]phenyl]ethynyl]-2-pyrrol-1-ylbenzoic acid |
| PubChem CID | 146907504 |
| Molecular Formula | C27H19F2NO4S |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 3-[2-[3-[2-(3,5-difluorophenyl)sulfonylethyl]phenyl]ethynyl]-2-pyrrol-1-ylbenzoic acid |
| SMILES | O=C(O)c1cccc(C#Cc2cccc(CCS(=O)(=O)c3cc(F)cc(F)c3)c2)c1-n1cccc1 |
| InChI | InChI=1S/C27H19F2NO4S/c28-22-16-23(29)18-24(17-22)35(33,34)14-11-20-6-3-5-19(15-20)9-10-21-7-4-8-25(27(31)32)26(21)30-12-1-2-13-30/h1-8,12-13,15-18H,11,14H2,(H,31,32) |
| InChIKey | AAQNGRMWVNUFIK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[3-[2-(3,5-difluorophenyl)sulfonylethyl]phenyl]ethynyl]-2-pyrrol-1-ylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[3-[2-(3,5-difluorophenyl)sulfonylethyl]phenyl]ethynyl]-2-pyrrol-1-ylbenzoic acid?
The IUPAC name of 3-[2-[3-[2-(3,5-difluorophenyl)sulfonylethyl]phenyl]ethynyl]-2-pyrrol-1-ylbenzoic acid (CID 146907504) is 3-[2-[3-[2-(3,5-difluorophenyl)sulfonylethyl]phenyl]ethynyl]-2-pyrrol-1-ylbenzoic acid.
What is the SMILES notation for 3-[2-[3-[2-(3,5-difluorophenyl)sulfonylethyl]phenyl]ethynyl]-2-pyrrol-1-ylbenzoic acid?
The canonical SMILES for 3-[2-[3-[2-(3,5-difluorophenyl)sulfonylethyl]phenyl]ethynyl]-2-pyrrol-1-ylbenzoic acid is O=C(O)c1cccc(C#Cc2cccc(CCS(=O)(=O)c3cc(F)cc(F)c3)c2)c1-n1cccc1.
What is the InChIKey of 3-[2-[3-[2-(3,5-difluorophenyl)sulfonylethyl]phenyl]ethynyl]-2-pyrrol-1-ylbenzoic acid?
The InChIKey is AAQNGRMWVNUFIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H19F2NO4S/c28-22-16-23(29)18-24(17-22)35(33,34)14-11-20-6-3-5-19(15-20)9-10-21-7-4-8-25(27(31)32)26(21)30-12-1-2-13-30/h1-8,12-13,15-18H,11,14H2,(H,31,32).
What are the key properties of 3-[2-[3-[2-(3,5-difluorophenyl)sulfonylethyl]phenyl]ethynyl]-2-pyrrol-1-ylbenzoic acid?
3-[2-[3-[2-(3,5-difluorophenyl)sulfonylethyl]phenyl]ethynyl]-2-pyrrol-1-ylbenzoic acid has a molecular weight of 491.52 g/mol, XLogP of 4.87, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[3-[2-(3,5-difluorophenyl)sulfonylethyl]phenyl]ethynyl]-2-pyrrol-1-ylbenzoic acid is sourced from PubChem (CID 146907504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).