About 4-[3-[(4,4-difluorocyclohexyl)methyl]-5-(4-fluorophenyl)imidazol-4-yl]pyrimidin-2-amine
4-[3-[(4,4-difluorocyclohexyl)methyl]-5-(4-fluorophenyl)imidazol-4-yl]pyrimidin-2-amine (PubChem CID 146914722) has the molecular formula C20H20F3N5
and a molecular weight of 387.41 g/mol. Its IUPAC name is 4-[3-[(4,4-difluorocyclohexyl)methyl]-5-(4-fluorophenyl)imidazol-4-yl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-[3-[(4,4-difluorocyclohexyl)methyl]-5-(4-fluorophenyl)imidazol-4-yl]pyrimidin-2-amine |
| PubChem CID | 146914722 |
| Molecular Formula | C20H20F3N5 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 4-[3-[(4,4-difluorocyclohexyl)methyl]-5-(4-fluorophenyl)imidazol-4-yl]pyrimidin-2-amine |
| SMILES | Nc1nccc(-c2c(-c3ccc(F)cc3)ncn2CC2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C20H20F3N5/c21-15-3-1-14(2-4-15)17-18(16-7-10-25-19(24)27-16)28(12-26-17)11-13-5-8-20(22,23)9-6-13/h1-4,7,10,12-13H,5-6,8-9,11H2,(H2,24,25,27) |
| InChIKey | ACAAGRQKIVPUBR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[3-[(4,4-difluorocyclohexyl)methyl]-5-(4-fluorophenyl)imidazol-4-yl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[(4,4-difluorocyclohexyl)methyl]-5-(4-fluorophenyl)imidazol-4-yl]pyrimidin-2-amine?
The IUPAC name of 4-[3-[(4,4-difluorocyclohexyl)methyl]-5-(4-fluorophenyl)imidazol-4-yl]pyrimidin-2-amine (CID 146914722) is 4-[3-[(4,4-difluorocyclohexyl)methyl]-5-(4-fluorophenyl)imidazol-4-yl]pyrimidin-2-amine.
What is the SMILES notation for 4-[3-[(4,4-difluorocyclohexyl)methyl]-5-(4-fluorophenyl)imidazol-4-yl]pyrimidin-2-amine?
The canonical SMILES for 4-[3-[(4,4-difluorocyclohexyl)methyl]-5-(4-fluorophenyl)imidazol-4-yl]pyrimidin-2-amine is Nc1nccc(-c2c(-c3ccc(F)cc3)ncn2CC2CCC(F)(F)CC2)n1.
What is the InChIKey of 4-[3-[(4,4-difluorocyclohexyl)methyl]-5-(4-fluorophenyl)imidazol-4-yl]pyrimidin-2-amine?
The InChIKey is ACAAGRQKIVPUBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F3N5/c21-15-3-1-14(2-4-15)17-18(16-7-10-25-19(24)27-16)28(12-26-17)11-13-5-8-20(22,23)9-6-13/h1-4,7,10,12-13H,5-6,8-9,11H2,(H2,24,25,27).
What are the key properties of 4-[3-[(4,4-difluorocyclohexyl)methyl]-5-(4-fluorophenyl)imidazol-4-yl]pyrimidin-2-amine?
4-[3-[(4,4-difluorocyclohexyl)methyl]-5-(4-fluorophenyl)imidazol-4-yl]pyrimidin-2-amine has a molecular weight of 387.41 g/mol, XLogP of 4.55, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[(4,4-difluorocyclohexyl)methyl]-5-(4-fluorophenyl)imidazol-4-yl]pyrimidin-2-amine is sourced from PubChem (CID 146914722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).