C25H23FN6O2 — CID 146915508
1-[3-[6-(3-fluoro-4-morpholin-4-ylanilino)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 146915508) has the molecular formula C25H23FN6O2 and a molecular weight of 458.50 g/mol. Its IUPAC name is 1-[3-[6-(3-fluoro-4-morpholin-4-ylanilino)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[3-[6-(3-fluoro-4-morpholin-4-ylanilino)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 146915508 |
| Molecular Formula | C25H23FN6O2 |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 1-[3-[6-(3-fluoro-4-morpholin-4-ylanilino)-1H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cccc(-c2nc(Nc3ccc(N4CCOCC4)c(F)c3)nc3[nH]ncc23)c1 |
| InChI | InChI=1S/C25H23FN6O2/c1-2-19(33)13-16-4-3-5-17(12-16)23-20-15-27-31-24(20)30-25(29-23)28-18-6-7-22(21(26)14-18)32-8-10-34-11-9-32/h2-7,12,14-15H,1,8-11,13H2,(H2,27,28,29,30,31) |
| InChIKey | ACDONPGURDFNTB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|