About 4-methoxycyclohexa-2,4-diene-1-sulfonamide
4-methoxycyclohexa-2,4-diene-1-sulfonamide (PubChem CID 146915691) has the molecular formula C7H11NO3S
and a molecular weight of 189.24 g/mol. Its IUPAC name is 4-methoxycyclohexa-2,4-diene-1-sulfonamide.
Molecular Properties
| Compound Name | 4-methoxycyclohexa-2,4-diene-1-sulfonamide |
| PubChem CID | 146915691 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 4-methoxycyclohexa-2,4-diene-1-sulfonamide |
| SMILES | COC1=CCC(S(N)(=O)=O)C=C1 |
| InChI | InChI=1S/C7H11NO3S/c1-11-6-2-4-7(5-3-6)12(8,9)10/h2-4,7H,5H2,1H3,(H2,8,9,10) |
| InChIKey | ACEJJHNHDAZJDZ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxycyclohexa-2,4-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxycyclohexa-2,4-diene-1-sulfonamide?
The IUPAC name of 4-methoxycyclohexa-2,4-diene-1-sulfonamide (CID 146915691) is 4-methoxycyclohexa-2,4-diene-1-sulfonamide.
What is the SMILES notation for 4-methoxycyclohexa-2,4-diene-1-sulfonamide?
The canonical SMILES for 4-methoxycyclohexa-2,4-diene-1-sulfonamide is COC1=CCC(S(N)(=O)=O)C=C1.
What is the InChIKey of 4-methoxycyclohexa-2,4-diene-1-sulfonamide?
The InChIKey is ACEJJHNHDAZJDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3S/c1-11-6-2-4-7(5-3-6)12(8,9)10/h2-4,7H,5H2,1H3,(H2,8,9,10).
What are the key properties of 4-methoxycyclohexa-2,4-diene-1-sulfonamide?
4-methoxycyclohexa-2,4-diene-1-sulfonamide has a molecular weight of 189.24 g/mol, XLogP of 0.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxycyclohexa-2,4-diene-1-sulfonamide is sourced from PubChem (CID 146915691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).