About 5-iodocyclohex-2-en-1-ol
5-iodocyclohex-2-en-1-ol (PubChem CID 146915953) has the molecular formula C6H9IO
and a molecular weight of 224.04 g/mol. Its IUPAC name is 5-iodocyclohex-2-en-1-ol.
Molecular Properties
| Compound Name | 5-iodocyclohex-2-en-1-ol |
| PubChem CID | 146915953 |
| Molecular Formula | C6H9IO |
| Molecular Weight | 224.04 g/mol |
| Exact Mass | 223.97 |
| IUPAC Name | 5-iodocyclohex-2-en-1-ol |
| SMILES | OC1C=CCC(I)C1 |
| InChI | InChI=1S/C6H9IO/c7-5-2-1-3-6(8)4-5/h1,3,5-6,8H,2,4H2 |
| InChIKey | ACFNZXNHBQTEJK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.04 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-iodocyclohex-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodocyclohex-2-en-1-ol?
The IUPAC name of 5-iodocyclohex-2-en-1-ol (CID 146915953) is 5-iodocyclohex-2-en-1-ol.
What is the SMILES notation for 5-iodocyclohex-2-en-1-ol?
The canonical SMILES for 5-iodocyclohex-2-en-1-ol is OC1C=CCC(I)C1.
What is the InChIKey of 5-iodocyclohex-2-en-1-ol?
The InChIKey is ACFNZXNHBQTEJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9IO/c7-5-2-1-3-6(8)4-5/h1,3,5-6,8H,2,4H2.
What are the key properties of 5-iodocyclohex-2-en-1-ol?
5-iodocyclohex-2-en-1-ol has a molecular weight of 224.04 g/mol, XLogP of 1.50, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodocyclohex-2-en-1-ol is sourced from PubChem (CID 146915953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).