About 4-methylpent-1-ene;yttrium
4-methylpent-1-ene;yttrium (PubChem CID 146916252) has the molecular formula C6H11Y-
and a molecular weight of 172.06 g/mol. Its IUPAC name is 4-methylpent-1-ene;yttrium.
Molecular Properties
| Compound Name | 4-methylpent-1-ene;yttrium |
| PubChem CID | 146916252 |
| Molecular Formula | C6H11Y- |
| Molecular Weight | 172.06 g/mol |
| Exact Mass | 171.99 |
| IUPAC Name | 4-methylpent-1-ene;yttrium |
| SMILES | C=[C-]CC(C)C.[Y] |
| InChI | InChI=1S/C6H11.Y/c1-4-5-6(2)3;/h6H,1,5H2,2-3H3;/q-1; |
| InChIKey | GNXARBCKWZDLKG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.06 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpent-1-ene;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpent-1-ene;yttrium?
The IUPAC name of 4-methylpent-1-ene;yttrium (CID 146916252) is 4-methylpent-1-ene;yttrium.
What is the SMILES notation for 4-methylpent-1-ene;yttrium?
The canonical SMILES for 4-methylpent-1-ene;yttrium is C=[C-]CC(C)C.[Y].
What is the InChIKey of 4-methylpent-1-ene;yttrium?
The InChIKey is GNXARBCKWZDLKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11.Y/c1-4-5-6(2)3;/h6H,1,5H2,2-3H3;/q-1;.
What are the key properties of 4-methylpent-1-ene;yttrium?
4-methylpent-1-ene;yttrium has a molecular weight of 172.06 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpent-1-ene;yttrium is sourced from PubChem (CID 146916252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).