C14H16OS — CID 14691764
S-ethyl 5-phenylhexa-3,4-dienethioate (PubChem CID 14691764) has the molecular formula C14H16OS and a molecular weight of 232.35 g/mol. Its IUPAC name is S-ethyl 5-phenylhexa-3,4-dienethioate.
| Compound Name | S-ethyl 5-phenylhexa-3,4-dienethioate |
|---|---|
| PubChem CID | 14691764 |
| Molecular Formula | C14H16OS |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | S-ethyl 5-phenylhexa-3,4-dienethioate |
| SMILES | CCSC(=O)CC=C=C(C)c1ccccc1 |
| InChI | InChI=1S/C14H16OS/c1-3-16-14(15)11-7-8-12(2)13-9-5-4-6-10-13/h4-7,9-10H,3,11H2,1-2H3 |
| InChIKey | ZIOYWTFORZSIFC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|