C26H20N4OS — CID 146918558
[5-amino-1-(2-methyl-3H-indol-5-yl)pyrazol-4-yl]-(6-thiophen-2-yl-1H-inden-2-yl)methanone (PubChem CID 146918558) has the molecular formula C26H20N4OS and a molecular weight of 436.54 g/mol. Its IUPAC name is [5-amino-1-(2-methyl-3H-indol-5-yl)pyrazol-4-yl]-(6-thiophen-2-yl-1H-inden-2-yl)methanone.
| Compound Name | [5-amino-1-(2-methyl-3H-indol-5-yl)pyrazol-4-yl]-(6-thiophen-2-yl-1H-inden-2-yl)methanone |
|---|---|
| PubChem CID | 146918558 |
| Molecular Formula | C26H20N4OS |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | [5-amino-1-(2-methyl-3H-indol-5-yl)pyrazol-4-yl]-(6-thiophen-2-yl-1H-inden-2-yl)methanone |
| SMILES | CC1=Nc2ccc(-n3ncc(C(=O)C4=Cc5ccc(-c6cccs6)cc5C4)c3N)cc2C1 |
| InChI | InChI=1S/C26H20N4OS/c1-15-9-19-13-21(6-7-23(19)29-15)30-26(27)22(14-28-30)25(31)20-10-16-4-5-17(11-18(16)12-20)24-3-2-8-32-24/h2-8,10-11,13-14H,9,12,27H2,1H3 |
| InChIKey | ACSJFGIVTWLJFE-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 73.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |