C20H19N3O2S — CID 146918873
N-[4-[4-(methylsulfonylmethyl)phenyl]but-3-ynyl]quinazolin-4-amine (PubChem CID 146918873) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-[4-[4-(methylsulfonylmethyl)phenyl]but-3-ynyl]quinazolin-4-amine.
| Compound Name | N-[4-[4-(methylsulfonylmethyl)phenyl]but-3-ynyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 146918873 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-[4-[4-(methylsulfonylmethyl)phenyl]but-3-ynyl]quinazolin-4-amine |
| SMILES | CS(=O)(=O)Cc1ccc(C#CCCNc2ncnc3ccccc23)cc1 |
| InChI | InChI=1S/C20H19N3O2S/c1-26(24,25)14-17-11-9-16(10-12-17)6-4-5-13-21-20-18-7-2-3-8-19(18)22-15-23-20/h2-3,7-12,15H,5,13-14H2,1H3,(H,21,22,23) |
| InChIKey | ACUADDSXSAWSPS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|