C35H40N6O5 — CID 146919397
10-[3-(hydroxymethyl)-4-[1-methyl-6-oxo-5-[[6-(4-oxohexoxy)-2-pyridinyl]amino]-3-pyridinyl]-2-pyridinyl]-4,4-dimethyl-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),7-dien-9-one (PubChem CID 146919397) has the molecular formula C35H40N6O5 and a molecular weight of 624.74 g/mol. Its IUPAC name is 10-[3-(hydroxymethyl)-4-[1-methyl-6-oxo-5-[[6-(4-oxohexoxy)-2-pyridinyl]amino]-3-pyridinyl]-2-pyridinyl]-4,4-dimethyl-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),7-dien-9-one.
| Compound Name | 10-[3-(hydroxymethyl)-4-[1-methyl-6-oxo-5-[[6-(4-oxohexoxy)-2-pyridinyl]amino]-3-pyridinyl]-2-pyridinyl]-4,4-dimethyl-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),7-dien-9-one |
|---|---|
| PubChem CID | 146919397 |
| Molecular Formula | C35H40N6O5 |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.31 |
| IUPAC Name | 10-[3-(hydroxymethyl)-4-[1-methyl-6-oxo-5-[[6-(4-oxohexoxy)-2-pyridinyl]amino]-3-pyridinyl]-2-pyridinyl]-4,4-dimethyl-1,10-diazatricyclo[6.4.0.02,6]dodeca-2(6),7-dien-9-one |
| SMILES | CCC(=O)CCCOc1cccc(Nc2cc(-c3ccnc(N4CCn5c(cc6c5CC(C)(C)C6)C4=O)c3CO)cn(C)c2=O)n1 |
| InChI | InChI=1S/C35H40N6O5/c1-5-24(43)8-7-15-46-31-10-6-9-30(38-31)37-27-16-23(20-39(4)33(27)44)25-11-12-36-32(26(25)21-42)41-14-13-40-28(34(41)45)17-22-18-35(2,3)19-29(22)40/h6,9-12,16-17,20,42H,5,7-8,13-15,18-19,21H2,1-4H3,(H,37,38) |
| InChIKey | ACWLQIIDQCDGAC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 131.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|