About N-(1-acetamido-2,2-dimethylpropyl)acetamide
N-(1-acetamido-2,2-dimethylpropyl)acetamide (PubChem CID 14691992) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is N-(1-acetamido-2,2-dimethylpropyl)acetamide.
Molecular Properties
| Compound Name | N-(1-acetamido-2,2-dimethylpropyl)acetamide |
| PubChem CID | 14691992 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | N-(1-acetamido-2,2-dimethylpropyl)acetamide |
| SMILES | CC(=O)NC(NC(C)=O)C(C)(C)C |
| InChI | InChI=1S/C9H18N2O2/c1-6(12)10-8(9(3,4)5)11-7(2)13/h8H,1-5H3,(H,10,12)(H,11,13) |
| InChIKey | UIYJUEJRKAKYFG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(1-acetamido-2,2-dimethylpropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-acetamido-2,2-dimethylpropyl)acetamide?
The IUPAC name of N-(1-acetamido-2,2-dimethylpropyl)acetamide (CID 14691992) is N-(1-acetamido-2,2-dimethylpropyl)acetamide.
What is the SMILES notation for N-(1-acetamido-2,2-dimethylpropyl)acetamide?
The canonical SMILES for N-(1-acetamido-2,2-dimethylpropyl)acetamide is CC(=O)NC(NC(C)=O)C(C)(C)C.
What is the InChIKey of N-(1-acetamido-2,2-dimethylpropyl)acetamide?
The InChIKey is UIYJUEJRKAKYFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-6(12)10-8(9(3,4)5)11-7(2)13/h8H,1-5H3,(H,10,12)(H,11,13).
What are the key properties of N-(1-acetamido-2,2-dimethylpropyl)acetamide?
N-(1-acetamido-2,2-dimethylpropyl)acetamide has a molecular weight of 186.25 g/mol, XLogP of 0.63, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-acetamido-2,2-dimethylpropyl)acetamide is sourced from PubChem (CID 14691992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).