C22H34N4O7 — CID 146920690
(2R,5S)-2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoic acid (PubChem CID 146920690) has the molecular formula C22H34N4O7 and a molecular weight of 466.54 g/mol. Its IUPAC name is (2R,5S)-2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoic acid.
| Compound Name | (2R,5S)-2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoic acid |
|---|---|
| PubChem CID | 146920690 |
| Molecular Formula | C22H34N4O7 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | (2R,5S)-2-[3-(carbamoylamino)propyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-6-methyl-4-oxoheptanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)C[C@@H](CCCNC(N)=O)C(=O)O |
| InChI | InChI=1S/C22H34N4O7/c1-14(2)20(16(27)13-15(21(31)32)7-6-11-24-22(23)33)25-17(28)8-4-3-5-12-26-18(29)9-10-19(26)30/h9-10,14-15,20H,3-8,11-13H2,1-2H3,(H,25,28)(H,31,32)(H3,23,24,33)/t15-,20+/m1/s1 |
| InChIKey | ADCVVPWPCIOIOD-QRWLVFNGSA-N |
| XLogP | 0.72 |
| TPSA | 175.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|