About 3-[(1R,2R)-1-methyl-2-phenylcyclopropyl]-1-(4-methylpiperazin-1-yl)propan-1-one
3-[(1R,2R)-1-methyl-2-phenylcyclopropyl]-1-(4-methylpiperazin-1-yl)propan-1-one (PubChem CID 146920807) has the molecular formula C18H26N2O
and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-[(1R,2R)-1-methyl-2-phenylcyclopropyl]-1-(4-methylpiperazin-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 3-[(1R,2R)-1-methyl-2-phenylcyclopropyl]-1-(4-methylpiperazin-1-yl)propan-1-one |
| PubChem CID | 146920807 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 3-[(1R,2R)-1-methyl-2-phenylcyclopropyl]-1-(4-methylpiperazin-1-yl)propan-1-one |
| SMILES | CN1CCN(C(=O)CC[C@]2(C)C[C@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C18H26N2O/c1-18(14-16(18)15-6-4-3-5-7-15)9-8-17(21)20-12-10-19(2)11-13-20/h3-7,16H,8-14H2,1-2H3/t16-,18+/m0/s1 |
| InChIKey | ADDJQSPSHTUNKB-FUHWJXTLSA-N |
| XLogP | 2.73 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(1R,2R)-1-methyl-2-phenylcyclopropyl]-1-(4-methylpiperazin-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R,2R)-1-methyl-2-phenylcyclopropyl]-1-(4-methylpiperazin-1-yl)propan-1-one?
The IUPAC name of 3-[(1R,2R)-1-methyl-2-phenylcyclopropyl]-1-(4-methylpiperazin-1-yl)propan-1-one (CID 146920807) is 3-[(1R,2R)-1-methyl-2-phenylcyclopropyl]-1-(4-methylpiperazin-1-yl)propan-1-one.
What is the SMILES notation for 3-[(1R,2R)-1-methyl-2-phenylcyclopropyl]-1-(4-methylpiperazin-1-yl)propan-1-one?
The canonical SMILES for 3-[(1R,2R)-1-methyl-2-phenylcyclopropyl]-1-(4-methylpiperazin-1-yl)propan-1-one is CN1CCN(C(=O)CC[C@]2(C)C[C@H]2c2ccccc2)CC1.
What is the InChIKey of 3-[(1R,2R)-1-methyl-2-phenylcyclopropyl]-1-(4-methylpiperazin-1-yl)propan-1-one?
The InChIKey is ADDJQSPSHTUNKB-FUHWJXTLSA-N. The full InChI is InChI=1S/C18H26N2O/c1-18(14-16(18)15-6-4-3-5-7-15)9-8-17(21)20-12-10-19(2)11-13-20/h3-7,16H,8-14H2,1-2H3/t16-,18+/m0/s1.
What are the key properties of 3-[(1R,2R)-1-methyl-2-phenylcyclopropyl]-1-(4-methylpiperazin-1-yl)propan-1-one?
3-[(1R,2R)-1-methyl-2-phenylcyclopropyl]-1-(4-methylpiperazin-1-yl)propan-1-one has a molecular weight of 286.42 g/mol, XLogP of 2.73, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,2R)-1-methyl-2-phenylcyclopropyl]-1-(4-methylpiperazin-1-yl)propan-1-one is sourced from PubChem (CID 146920807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).