C36H45F3O5 — CID 14692673
[4-[(2R)-1,1,1-trifluorooctan-2-yl]oxycarbonylphenyl] 6-decoxynaphthalene-2-carboxylate (PubChem CID 14692673) has the molecular formula C36H45F3O5 and a molecular weight of 614.75 g/mol. Its IUPAC name is [4-[(2R)-1,1,1-trifluorooctan-2-yl]oxycarbonylphenyl] 6-decoxynaphthalene-2-carboxylate.
| Compound Name | [4-[(2R)-1,1,1-trifluorooctan-2-yl]oxycarbonylphenyl] 6-decoxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 14692673 |
| Molecular Formula | C36H45F3O5 |
| Molecular Weight | 614.75 g/mol |
| Exact Mass | 614.32 |
| IUPAC Name | [4-[(2R)-1,1,1-trifluorooctan-2-yl]oxycarbonylphenyl] 6-decoxynaphthalene-2-carboxylate |
| SMILES | CCCCCCCCCCOc1ccc2cc(C(=O)Oc3ccc(C(=O)O[C@H](CCCCCC)C(F)(F)F)cc3)ccc2c1 |
| InChI | InChI=1S/C36H45F3O5/c1-3-5-7-9-10-11-12-14-24-42-32-23-20-28-25-30(17-16-29(28)26-32)35(41)43-31-21-18-27(19-22-31)34(40)44-33(36(37,38)39)15-13-8-6-4-2/h16-23,25-26,33H,3-15,24H2,1-2H3/t33-/m1/s1 |
| InChIKey | GNDNQIJFNZARKI-MGBGTMOVSA-N |
| XLogP | 10.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.75 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|