C25H19ClF3N3O2 — CID 146932243
4-[(4-chlorophenyl)methoxy]-2-[4-[3-(methyliminomethyl)phenyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]phenol (PubChem CID 146932243) has the molecular formula C25H19ClF3N3O2 and a molecular weight of 485.89 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methoxy]-2-[4-[3-(methyliminomethyl)phenyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]phenol.
| Compound Name | 4-[(4-chlorophenyl)methoxy]-2-[4-[3-(methyliminomethyl)phenyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]phenol |
|---|---|
| PubChem CID | 146932243 |
| Molecular Formula | C25H19ClF3N3O2 |
| Molecular Weight | 485.89 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 4-[(4-chlorophenyl)methoxy]-2-[4-[3-(methyliminomethyl)phenyl]-5-(trifluoromethyl)-1H-pyrazol-3-yl]phenol |
| SMILES | C/N=C/c1cccc(-c2c(-c3cc(OCc4ccc(Cl)cc4)ccc3O)n[nH]c2C(F)(F)F)c1 |
| InChI | InChI=1S/C25H19ClF3N3O2/c1-30-13-16-3-2-4-17(11-16)22-23(31-32-24(22)25(27,28)29)20-12-19(9-10-21(20)33)34-14-15-5-7-18(26)8-6-15/h2-13,33H,14H2,1H3,(H,31,32)/b30-13+ |
| InChIKey | AFGFRHPWOKWPJD-VVEOGCPPSA-N |
| XLogP | 6.75 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.89 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|