C43H25F6N5 — CID 146933083
9-[3-[4,6-bis[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]phenyl]-3-indol-1-ylcarbazole (PubChem CID 146933083) has the molecular formula C43H25F6N5 and a molecular weight of 725.70 g/mol. Its IUPAC name is 9-[3-[4,6-bis[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]phenyl]-3-indol-1-ylcarbazole.
| Compound Name | 9-[3-[4,6-bis[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]phenyl]-3-indol-1-ylcarbazole |
|---|---|
| PubChem CID | 146933083 |
| Molecular Formula | C43H25F6N5 |
| Molecular Weight | 725.70 g/mol |
| Exact Mass | 725.20 |
| IUPAC Name | 9-[3-[4,6-bis[4-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]phenyl]-3-indol-1-ylcarbazole |
| SMILES | FC(F)(F)c1ccc(-c2nc(-c3ccc(C(F)(F)F)cc3)nc(-c3cccc(-n4c5ccccc5c5cc(-n6ccc7ccccc76)ccc54)c3)n2)cc1 |
| InChI | InChI=1S/C43H25F6N5/c44-42(45,46)30-16-12-27(13-17-30)39-50-40(28-14-18-31(19-15-28)43(47,48)49)52-41(51-39)29-7-5-8-33(24-29)54-37-11-4-2-9-34(37)35-25-32(20-21-38(35)54)53-23-22-26-6-1-3-10-36(26)53/h1-25H |
| InChIKey | AFKDDALRJVUXHF-UHFFFAOYSA-N |
| XLogP | 11.95 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.70 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |