C13H29O4P — CID 14693345
1-[3,3-diethoxypropyl(methyl)phosphoryl]oxypentane (PubChem CID 14693345) has the molecular formula C13H29O4P and a molecular weight of 280.34 g/mol. Its IUPAC name is 1-[3,3-diethoxypropyl(methyl)phosphoryl]oxypentane.
| Compound Name | 1-[3,3-diethoxypropyl(methyl)phosphoryl]oxypentane |
|---|---|
| PubChem CID | 14693345 |
| Molecular Formula | C13H29O4P |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-[3,3-diethoxypropyl(methyl)phosphoryl]oxypentane |
| SMILES | CCCCCOP(C)(=O)CCC(OCC)OCC |
| InChI | InChI=1S/C13H29O4P/c1-5-8-9-11-17-18(4,14)12-10-13(15-6-2)16-7-3/h13H,5-12H2,1-4H3 |
| InChIKey | MDSXENPHXILFFY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|