About 4-propan-2-ylthieno[2,3-b][1,4]benzoxazin-3-amine
4-propan-2-ylthieno[2,3-b][1,4]benzoxazin-3-amine (PubChem CID 146937184) has the molecular formula C13H14N2OS
and a molecular weight of 246.34 g/mol. Its IUPAC name is 4-propan-2-ylthieno[2,3-b][1,4]benzoxazin-3-amine.
Molecular Properties
| Compound Name | 4-propan-2-ylthieno[2,3-b][1,4]benzoxazin-3-amine |
| PubChem CID | 146937184 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 4-propan-2-ylthieno[2,3-b][1,4]benzoxazin-3-amine |
| SMILES | CC(C)N1c2ccccc2Oc2scc(N)c21 |
| InChI | InChI=1S/C13H14N2OS/c1-8(2)15-10-5-3-4-6-11(10)16-13-12(15)9(14)7-17-13/h3-8H,14H2,1-2H3 |
| InChIKey | AGDSZGGFKTVTAH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-propan-2-ylthieno[2,3-b][1,4]benzoxazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-ylthieno[2,3-b][1,4]benzoxazin-3-amine?
The IUPAC name of 4-propan-2-ylthieno[2,3-b][1,4]benzoxazin-3-amine (CID 146937184) is 4-propan-2-ylthieno[2,3-b][1,4]benzoxazin-3-amine.
What is the SMILES notation for 4-propan-2-ylthieno[2,3-b][1,4]benzoxazin-3-amine?
The canonical SMILES for 4-propan-2-ylthieno[2,3-b][1,4]benzoxazin-3-amine is CC(C)N1c2ccccc2Oc2scc(N)c21.
What is the InChIKey of 4-propan-2-ylthieno[2,3-b][1,4]benzoxazin-3-amine?
The InChIKey is AGDSZGGFKTVTAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2OS/c1-8(2)15-10-5-3-4-6-11(10)16-13-12(15)9(14)7-17-13/h3-8H,14H2,1-2H3.
What are the key properties of 4-propan-2-ylthieno[2,3-b][1,4]benzoxazin-3-amine?
4-propan-2-ylthieno[2,3-b][1,4]benzoxazin-3-amine has a molecular weight of 246.34 g/mol, XLogP of 3.98, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-ylthieno[2,3-b][1,4]benzoxazin-3-amine is sourced from PubChem (CID 146937184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).