C17H22N7O2+ — CID 146940659
(5S)-N-(5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)-6'-methoxyspiro[4H-1,3-oxazole-5,4'-6-azoniatricyclo[4.2.0.01,3]octane]-2-amine (PubChem CID 146940659) has the molecular formula C17H22N7O2+ and a molecular weight of 356.41 g/mol. Its IUPAC name is (5S)-N-(5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)-6'-methoxyspiro[4H-1,3-oxazole-5,4'-6-azoniatricyclo[4.2.0.01,3]octane]-2-amine.
| Compound Name | (5S)-N-(5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)-6'-methoxyspiro[4H-1,3-oxazole-5,4'-6-azoniatricyclo[4.2.0.01,3]octane]-2-amine |
|---|---|
| PubChem CID | 146940659 |
| Molecular Formula | C17H22N7O2+ |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (5S)-N-(5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrazin-2-yl)-6'-methoxyspiro[4H-1,3-oxazole-5,4'-6-azoniatricyclo[4.2.0.01,3]octane]-2-amine |
| SMILES | CO[N+]12CCC13CC3[C@]1(CN=C(Nc3nc4cnc(C)c(C)n4n3)O1)C2 |
| InChI | InChI=1S/C17H22N7O2/c1-10-11(2)23-13(7-18-10)20-14(22-23)21-15-19-8-17(26-15)9-24(25-3)5-4-16(24)6-12(16)17/h7,12H,4-6,8-9H2,1-3H3,(H,19,21,22)/q+1/t12?,16?,17-,24?/m0/s1 |
| InChIKey | AGUOZTWHJNQDDE-BATKBKCVSA-N |
| XLogP | 0.83 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|