C27H29FN4O3 — CID 146940697
2-fluoro-4-[5-[4-(2-methoxyethoxy)phenyl]-1-methyl-2-(4-methylpiperidin-1-yl)-6-oxopyrimidin-4-yl]benzonitrile (PubChem CID 146940697) has the molecular formula C27H29FN4O3 and a molecular weight of 476.55 g/mol. Its IUPAC name is 2-fluoro-4-[5-[4-(2-methoxyethoxy)phenyl]-1-methyl-2-(4-methylpiperidin-1-yl)-6-oxopyrimidin-4-yl]benzonitrile.
| Compound Name | 2-fluoro-4-[5-[4-(2-methoxyethoxy)phenyl]-1-methyl-2-(4-methylpiperidin-1-yl)-6-oxopyrimidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 146940697 |
| Molecular Formula | C27H29FN4O3 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 2-fluoro-4-[5-[4-(2-methoxyethoxy)phenyl]-1-methyl-2-(4-methylpiperidin-1-yl)-6-oxopyrimidin-4-yl]benzonitrile |
| SMILES | COCCOc1ccc(-c2c(-c3ccc(C#N)c(F)c3)nc(N3CCC(C)CC3)n(C)c2=O)cc1 |
| InChI | InChI=1S/C27H29FN4O3/c1-18-10-12-32(13-11-18)27-30-25(20-4-5-21(17-29)23(28)16-20)24(26(33)31(27)2)19-6-8-22(9-7-19)35-15-14-34-3/h4-9,16,18H,10-15H2,1-3H3 |
| InChIKey | AGUUBDVQFDWKIY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 80.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|