C19H35F2N5O2 — CID 146941979
1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[4-[(2,2-difluoro-3-hydroxypropyl)amino]-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 146941979) has the molecular formula C19H35F2N5O2 and a molecular weight of 403.52 g/mol. Its IUPAC name is 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[4-[(2,2-difluoro-3-hydroxypropyl)amino]-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[4-[(2,2-difluoro-3-hydroxypropyl)amino]-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 146941979 |
| Molecular Formula | C19H35F2N5O2 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.28 |
| IUPAC Name | 1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-3-[4-[(2,2-difluoro-3-hydroxypropyl)amino]-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CC1CC(NCC(F)(F)CO)NC(NC(=O)NC2CCC3CCCCC3C2)N1 |
| InChI | InChI=1S/C19H35F2N5O2/c1-12-8-16(22-10-19(20,21)11-27)25-17(23-12)26-18(28)24-15-7-6-13-4-2-3-5-14(13)9-15/h12-17,22-23,25,27H,2-11H2,1H3,(H2,24,26,28) |
| InChIKey | UHDNUMGSMZRNTL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |