About N-[1-(6-chloro-2,7-dimethoxyquinolin-3-yl)ethylidene]-2-methylpropane-2-sulfinamide
N-[1-(6-chloro-2,7-dimethoxyquinolin-3-yl)ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 146944204) has the molecular formula C17H21ClN2O3S
and a molecular weight of 368.89 g/mol. Its IUPAC name is N-[1-(6-chloro-2,7-dimethoxyquinolin-3-yl)ethylidene]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | N-[1-(6-chloro-2,7-dimethoxyquinolin-3-yl)ethylidene]-2-methylpropane-2-sulfinamide |
| PubChem CID | 146944204 |
| Molecular Formula | C17H21ClN2O3S |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-[1-(6-chloro-2,7-dimethoxyquinolin-3-yl)ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | COc1cc2nc(OC)c(C(C)=NS(=O)C(C)(C)C)cc2cc1Cl |
| InChI | InChI=1S/C17H21ClN2O3S/c1-10(20-24(21)17(2,3)4)12-7-11-8-13(18)15(22-5)9-14(11)19-16(12)23-6/h7-9H,1-6H3 |
| InChIKey | FZMXICHVAHYYBY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(6-chloro-2,7-dimethoxyquinolin-3-yl)ethylidene]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(6-chloro-2,7-dimethoxyquinolin-3-yl)ethylidene]-2-methylpropane-2-sulfinamide?
The IUPAC name of N-[1-(6-chloro-2,7-dimethoxyquinolin-3-yl)ethylidene]-2-methylpropane-2-sulfinamide (CID 146944204) is N-[1-(6-chloro-2,7-dimethoxyquinolin-3-yl)ethylidene]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for N-[1-(6-chloro-2,7-dimethoxyquinolin-3-yl)ethylidene]-2-methylpropane-2-sulfinamide?
The canonical SMILES for N-[1-(6-chloro-2,7-dimethoxyquinolin-3-yl)ethylidene]-2-methylpropane-2-sulfinamide is COc1cc2nc(OC)c(C(C)=NS(=O)C(C)(C)C)cc2cc1Cl.
What is the InChIKey of N-[1-(6-chloro-2,7-dimethoxyquinolin-3-yl)ethylidene]-2-methylpropane-2-sulfinamide?
The InChIKey is FZMXICHVAHYYBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClN2O3S/c1-10(20-24(21)17(2,3)4)12-7-11-8-13(18)15(22-5)9-14(11)19-16(12)23-6/h7-9H,1-6H3.
What are the key properties of N-[1-(6-chloro-2,7-dimethoxyquinolin-3-yl)ethylidene]-2-methylpropane-2-sulfinamide?
N-[1-(6-chloro-2,7-dimethoxyquinolin-3-yl)ethylidene]-2-methylpropane-2-sulfinamide has a molecular weight of 368.89 g/mol, XLogP of 4.18, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(6-chloro-2,7-dimethoxyquinolin-3-yl)ethylidene]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 146944204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).