C22H25F3N6O3 — CID 146944697
(9S)-N-[4-(2-hydroxyethylamino)-2-pyridinyl]-5-[(3S)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 146944697) has the molecular formula C22H25F3N6O3 and a molecular weight of 478.48 g/mol. Its IUPAC name is (9S)-N-[4-(2-hydroxyethylamino)-2-pyridinyl]-5-[(3S)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[4-(2-hydroxyethylamino)-2-pyridinyl]-5-[(3S)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 146944697 |
| Molecular Formula | C22H25F3N6O3 |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | (9S)-N-[4-(2-hydroxyethylamino)-2-pyridinyl]-5-[(3S)-4,4,4-trifluoro-3-methylbutanoyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | C[C@@H](CC(=O)c1ccc2c(n1)N(C(=O)Nc1cc(NCCO)ccn1)[C@H]1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C22H25F3N6O3/c1-13(22(23,24)25)10-18(33)16-2-3-17-20(28-16)31(15-5-8-30(17)12-15)21(34)29-19-11-14(4-6-27-19)26-7-9-32/h2-4,6,11,13,15,32H,5,7-10,12H2,1H3,(H2,26,27,29,34)/t13-,15-/m0/s1 |
| InChIKey | AHOJZOCUNGPJSH-ZFWWWQNUSA-N |
| XLogP | 3.28 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |