C27H30N4O4 — CID 146949249
9-acetyl-3-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-methylimino-1,9-diazaspiro[4.5]decan-4-one (PubChem CID 146949249) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is 9-acetyl-3-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-methylimino-1,9-diazaspiro[4.5]decan-4-one.
| Compound Name | 9-acetyl-3-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-methylimino-1,9-diazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 146949249 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 9-acetyl-3-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-methylimino-1,9-diazaspiro[4.5]decan-4-one |
| SMILES | C/N=C1/C(=C2Cc3ccccc3N2)C(=O)C2(CCCN(C(C)=O)C2)N1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C27H30N4O4/c1-17(32)30-11-7-10-27(16-30)25(33)24(23-12-18-8-5-6-9-22(18)29-23)26(28-2)31(27)19-13-20(34-3)15-21(14-19)35-4/h5-6,8-9,13-15,29H,7,10-12,16H2,1-4H3/b24-23?,28-26- |
| InChIKey | KTNZGWPLSNAVJZ-YAOJISRCSA-N |
| XLogP | 3.42 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|