C26H25F2N2O5+ — CID 146953853
2-[3-[[2-(6-fluoro-1H-indol-3-yl)-1-(4-fluoro-2-methoxyphenyl)-2-oxoethyl]amino]-5-methoxyphenoxy]ethyloxidanium (PubChem CID 146953853) has the molecular formula C26H25F2N2O5+ and a molecular weight of 483.49 g/mol. Its IUPAC name is 2-[3-[[2-(6-fluoro-1H-indol-3-yl)-1-(4-fluoro-2-methoxyphenyl)-2-oxoethyl]amino]-5-methoxyphenoxy]ethyloxidanium.
| Compound Name | 2-[3-[[2-(6-fluoro-1H-indol-3-yl)-1-(4-fluoro-2-methoxyphenyl)-2-oxoethyl]amino]-5-methoxyphenoxy]ethyloxidanium |
|---|---|
| PubChem CID | 146953853 |
| Molecular Formula | C26H25F2N2O5+ |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 2-[3-[[2-(6-fluoro-1H-indol-3-yl)-1-(4-fluoro-2-methoxyphenyl)-2-oxoethyl]amino]-5-methoxyphenoxy]ethyloxidanium |
| SMILES | COc1cc(NC(C(=O)c2c[nH]c3cc(F)ccc23)c2ccc(F)cc2OC)cc(OCC[OH2+])c1 |
| InChI | InChI=1S/C26H24F2N2O5/c1-33-18-11-17(12-19(13-18)35-8-7-31)30-25(21-6-4-16(28)10-24(21)34-2)26(32)22-14-29-23-9-15(27)3-5-20(22)23/h3-6,9-14,25,29-31H,7-8H2,1-2H3/p+1 |
| InChIKey | AJGCMPLSBOSHGP-UHFFFAOYSA-O |
| XLogP | 4.60 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|