C30H28FN5O3 — CID 146955092
(3S)-3-[[5-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-fluorophenyl]-1,3,4-oxadiazol-2-yl]amino]-1-phenyl-3,5-dihydro-2-benzazepin-4-one (PubChem CID 146955092) has the molecular formula C30H28FN5O3 and a molecular weight of 525.58 g/mol. Its IUPAC name is (3S)-3-[[5-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-fluorophenyl]-1,3,4-oxadiazol-2-yl]amino]-1-phenyl-3,5-dihydro-2-benzazepin-4-one.
| Compound Name | (3S)-3-[[5-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-fluorophenyl]-1,3,4-oxadiazol-2-yl]amino]-1-phenyl-3,5-dihydro-2-benzazepin-4-one |
|---|---|
| PubChem CID | 146955092 |
| Molecular Formula | C30H28FN5O3 |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | (3S)-3-[[5-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-fluorophenyl]-1,3,4-oxadiazol-2-yl]amino]-1-phenyl-3,5-dihydro-2-benzazepin-4-one |
| SMILES | C[C@@H]1CN(c2cc(F)ccc2-c2nnc(N[C@H]3N=C(c4ccccc4)c4ccccc4CC3=O)o2)C[C@H](C)O1 |
| InChI | InChI=1S/C30H28FN5O3/c1-18-16-36(17-19(2)38-18)25-15-22(31)12-13-24(25)29-34-35-30(39-29)33-28-26(37)14-21-10-6-7-11-23(21)27(32-28)20-8-4-3-5-9-20/h3-13,15,18-19,28H,14,16-17H2,1-2H3,(H,33,35)/t18-,19+,28-/m1/s1 |
| InChIKey | AJLYUMSJPDHSMI-FSQFJQELSA-N |
| XLogP | 4.89 |
| TPSA | 92.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |