C15H15Cl2NO4 — CID 14695564
3-(2,4-dichloro-5-propan-2-yloxyphenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione (PubChem CID 14695564) has the molecular formula C15H15Cl2NO4 and a molecular weight of 344.19 g/mol. Its IUPAC name is 3-(2,4-dichloro-5-propan-2-yloxyphenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-(2,4-dichloro-5-propan-2-yloxyphenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 14695564 |
| Molecular Formula | C15H15Cl2NO4 |
| Molecular Weight | 344.19 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 3-(2,4-dichloro-5-propan-2-yloxyphenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione |
| SMILES | CC(C)=C1OC(=O)N(c2cc(OC(C)C)c(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C15H15Cl2NO4/c1-7(2)13-14(19)18(15(20)22-13)11-6-12(21-8(3)4)10(17)5-9(11)16/h5-6,8H,1-4H3 |
| InChIKey | UAWGAUHPTOIDFJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.19 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|