C20H21N5O5S — CID 146958189
2-[3-(4-ethoxybutanoyl)azetidin-1-yl]-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid (PubChem CID 146958189) has the molecular formula C20H21N5O5S and a molecular weight of 443.49 g/mol. Its IUPAC name is 2-[3-(4-ethoxybutanoyl)azetidin-1-yl]-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid.
| Compound Name | 2-[3-(4-ethoxybutanoyl)azetidin-1-yl]-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 146958189 |
| Molecular Formula | C20H21N5O5S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-[3-(4-ethoxybutanoyl)azetidin-1-yl]-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid |
| SMILES | CCOCCCC(=O)C1CN(c2ncc3c(=O)c(C(=O)O)cn(-c4nccs4)c3n2)C1 |
| InChI | InChI=1S/C20H21N5O5S/c1-2-30-6-3-4-15(26)12-9-24(10-12)19-22-8-13-16(27)14(18(28)29)11-25(17(13)23-19)20-21-5-7-31-20/h5,7-8,11-12H,2-4,6,9-10H2,1H3,(H,28,29) |
| InChIKey | AKBFDHHLRUXMBQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|