C25H36O5 — CID 14695939
(8S,9S,10S,13S,14S,17S)-13-methyl-17-(2-methyl-1,3-dioxolan-2-yl)spiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-10-carbaldehyde (PubChem CID 14695939) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is (8S,9S,10S,13S,14S,17S)-13-methyl-17-(2-methyl-1,3-dioxolan-2-yl)spiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-10-carbaldehyde.
| Compound Name | (8S,9S,10S,13S,14S,17S)-13-methyl-17-(2-methyl-1,3-dioxolan-2-yl)spiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-10-carbaldehyde |
|---|---|
| PubChem CID | 14695939 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (8S,9S,10S,13S,14S,17S)-13-methyl-17-(2-methyl-1,3-dioxolan-2-yl)spiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-10-carbaldehyde |
| SMILES | CC1([C@H]2CC[C@H]3[C@@H]4CC=C5CC6(CC[C@]5(C=O)[C@H]4CC[C@]23C)OCCO6)OCCO1 |
| InChI | InChI=1S/C25H36O5/c1-22-8-7-20-18(19(22)5-6-21(22)23(2)27-11-12-28-23)4-3-17-15-25(29-13-14-30-25)10-9-24(17,20)16-26/h3,16,18-21H,4-15H2,1-2H3/t18-,19-,20-,21-,22-,24+/m0/s1 |
| InChIKey | OTIIVJMOQBAZMI-JSFPSQRZSA-N |
| XLogP | 4.25 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|