About 4-fluoro-5-methylbenzene-1,2-dicarbonitrile
4-fluoro-5-methylbenzene-1,2-dicarbonitrile (PubChem CID 146962290) has the molecular formula C9H5FN2
and a molecular weight of 160.15 g/mol. Its IUPAC name is 4-fluoro-5-methylbenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-fluoro-5-methylbenzene-1,2-dicarbonitrile |
| PubChem CID | 146962290 |
| Molecular Formula | C9H5FN2 |
| Molecular Weight | 160.15 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | 4-fluoro-5-methylbenzene-1,2-dicarbonitrile |
| SMILES | Cc1cc(C#N)c(C#N)cc1F |
| InChI | InChI=1S/C9H5FN2/c1-6-2-7(4-11)8(5-12)3-9(6)10/h2-3H,1H3 |
| InChIKey | AKUXDCSFUCFIAL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.15 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-5-methylbenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-5-methylbenzene-1,2-dicarbonitrile?
The IUPAC name of 4-fluoro-5-methylbenzene-1,2-dicarbonitrile (CID 146962290) is 4-fluoro-5-methylbenzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-fluoro-5-methylbenzene-1,2-dicarbonitrile?
The canonical SMILES for 4-fluoro-5-methylbenzene-1,2-dicarbonitrile is Cc1cc(C#N)c(C#N)cc1F.
What is the InChIKey of 4-fluoro-5-methylbenzene-1,2-dicarbonitrile?
The InChIKey is AKUXDCSFUCFIAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5FN2/c1-6-2-7(4-11)8(5-12)3-9(6)10/h2-3H,1H3.
What are the key properties of 4-fluoro-5-methylbenzene-1,2-dicarbonitrile?
4-fluoro-5-methylbenzene-1,2-dicarbonitrile has a molecular weight of 160.15 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-5-methylbenzene-1,2-dicarbonitrile is sourced from PubChem (CID 146962290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).