C19H14O4 — CID 146964961
1,6,6-trimethylnaphtho[1,2-g][1]benzofuran-7,10,11-trione (PubChem CID 146964961) has the molecular formula C19H14O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is 1,6,6-trimethylnaphtho[1,2-g][1]benzofuran-7,10,11-trione.
| Compound Name | 1,6,6-trimethylnaphtho[1,2-g][1]benzofuran-7,10,11-trione |
|---|---|
| PubChem CID | 146964961 |
| Molecular Formula | C19H14O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 1,6,6-trimethylnaphtho[1,2-g][1]benzofuran-7,10,11-trione |
| SMILES | Cc1coc2c1C(=O)C(=O)c1c-2ccc2c1C=CC(=O)C2(C)C |
| InChI | InChI=1S/C19H14O4/c1-9-8-23-18-11-4-6-12-10(5-7-13(20)19(12,2)3)15(11)17(22)16(21)14(9)18/h4-8H,1-3H3 |
| InChIKey | ALHWFXUZICSNIA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|